C21H29N5O — CID 97193467
N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-3-[(3S)-piperidin-3-yl]benzamide (PubChem CID 97193467) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-3-[(3S)-piperidin-3-yl]benzamide.
| Compound Name | N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-3-[(3S)-piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 97193467 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-3-[(3S)-piperidin-3-yl]benzamide |
| SMILES | O=C(NCc1nncn1C1CCCCC1)c1cccc([C@@H]2CCCNC2)c1 |
| InChI | InChI=1S/C21H29N5O/c27-21(17-7-4-6-16(12-17)18-8-5-11-22-13-18)23-14-20-25-24-15-26(20)19-9-2-1-3-10-19/h4,6-7,12,15,18-19,22H,1-3,5,8-11,13-14H2,(H,23,27)/t18-/m1/s1 |
| InChIKey | OYJSVGDVOQOFHY-GOSISDBHSA-N |
| XLogP | 3.18 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |