C16H21N5O3S — CID 77092303
N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-4-sulfamoylbenzamide (PubChem CID 77092303) has the molecular formula C16H21N5O3S and a molecular weight of 363.44 g/mol. Its IUPAC name is N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-4-sulfamoylbenzamide.
| Compound Name | N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 77092303 |
| Molecular Formula | C16H21N5O3S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | N-[(4-cyclohexyl-1,2,4-triazol-3-yl)methyl]-4-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)NCc2nncn2C2CCCCC2)cc1 |
| InChI | InChI=1S/C16H21N5O3S/c17-25(23,24)14-8-6-12(7-9-14)16(22)18-10-15-20-19-11-21(15)13-4-2-1-3-5-13/h6-9,11,13H,1-5,10H2,(H,18,22)(H2,17,23,24) |
| InChIKey | NPLXEWAPLMSZGL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |