C17H22N4O4S — CID 131918632
3-[(4-cyclohexyl-1,2,4-triazol-3-yl)methylsulfamoyl]-4-methylbenzoic acid (PubChem CID 131918632) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is 3-[(4-cyclohexyl-1,2,4-triazol-3-yl)methylsulfamoyl]-4-methylbenzoic acid.
| Compound Name | 3-[(4-cyclohexyl-1,2,4-triazol-3-yl)methylsulfamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 131918632 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 3-[(4-cyclohexyl-1,2,4-triazol-3-yl)methylsulfamoyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1S(=O)(=O)NCc1nncn1C1CCCCC1 |
| InChI | InChI=1S/C17H22N4O4S/c1-12-7-8-13(17(22)23)9-15(12)26(24,25)19-10-16-20-18-11-21(16)14-5-3-2-4-6-14/h7-9,11,14,19H,2-6,10H2,1H3,(H,22,23) |
| InChIKey | RUUSJFGRZFSOTL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |