C17H23N5O3S — CID 131945022
N-[3-[(4-cyclohexyl-1,2,4-triazol-3-yl)methylsulfamoyl]phenyl]acetamide (PubChem CID 131945022) has the molecular formula C17H23N5O3S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-[3-[(4-cyclohexyl-1,2,4-triazol-3-yl)methylsulfamoyl]phenyl]acetamide.
| Compound Name | N-[3-[(4-cyclohexyl-1,2,4-triazol-3-yl)methylsulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 131945022 |
| Molecular Formula | C17H23N5O3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[3-[(4-cyclohexyl-1,2,4-triazol-3-yl)methylsulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(S(=O)(=O)NCc2nncn2C2CCCCC2)c1 |
| InChI | InChI=1S/C17H23N5O3S/c1-13(23)20-14-6-5-9-16(10-14)26(24,25)19-11-17-21-18-12-22(17)15-7-3-2-4-8-15/h5-6,9-10,12,15,19H,2-4,7-8,11H2,1H3,(H,20,23) |
| InChIKey | ONWXWKAQVFFBQX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |