C18H24N4OS2 — CID 77086327
N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-piperidin-3-ylbenzamide (PubChem CID 77086327) has the molecular formula C18H24N4OS2 and a molecular weight of 376.55 g/mol. Its IUPAC name is N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-piperidin-3-ylbenzamide.
| Compound Name | N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-piperidin-3-ylbenzamide |
|---|---|
| PubChem CID | 77086327 |
| Molecular Formula | C18H24N4OS2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-piperidin-3-ylbenzamide |
| SMILES | Cc1nnc(SCCCNC(=O)c2cccc(C3CCCNC3)c2)s1 |
| InChI | InChI=1S/C18H24N4OS2/c1-13-21-22-18(25-13)24-10-4-9-20-17(23)15-6-2-5-14(11-15)16-7-3-8-19-12-16/h2,5-6,11,16,19H,3-4,7-10,12H2,1H3,(H,20,23) |
| InChIKey | YWXPMDDEUIBUPC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|