C21H28N4O — CID 97195958
N-[3-(5-cyclopropylpyrazol-1-yl)propyl]-3-[(3R)-piperidin-3-yl]benzamide (PubChem CID 97195958) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is N-[3-(5-cyclopropylpyrazol-1-yl)propyl]-3-[(3R)-piperidin-3-yl]benzamide.
| Compound Name | N-[3-(5-cyclopropylpyrazol-1-yl)propyl]-3-[(3R)-piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 97195958 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | N-[3-(5-cyclopropylpyrazol-1-yl)propyl]-3-[(3R)-piperidin-3-yl]benzamide |
| SMILES | O=C(NCCCn1nccc1C1CC1)c1cccc([C@H]2CCCNC2)c1 |
| InChI | InChI=1S/C21H28N4O/c26-21(18-5-1-4-17(14-18)19-6-2-10-22-15-19)23-11-3-13-25-20(9-12-24-25)16-7-8-16/h1,4-5,9,12,14,16,19,22H,2-3,6-8,10-11,13,15H2,(H,23,26)/t19-/m0/s1 |
| InChIKey | YHEZACKMQNUYFH-IBGZPJMESA-N |
| XLogP | 3.05 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|