C19H24FN5O2 — CID 126431022
4-fluoro-N-[2-[[2-[5-[(3S)-piperidin-3-yl]pyrazol-1-yl]acetyl]amino]ethyl]benzamide (PubChem CID 126431022) has the molecular formula C19H24FN5O2 and a molecular weight of 373.43 g/mol. Its IUPAC name is 4-fluoro-N-[2-[[2-[5-[(3S)-piperidin-3-yl]pyrazol-1-yl]acetyl]amino]ethyl]benzamide.
| Compound Name | 4-fluoro-N-[2-[[2-[5-[(3S)-piperidin-3-yl]pyrazol-1-yl]acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 126431022 |
| Molecular Formula | C19H24FN5O2 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 4-fluoro-N-[2-[[2-[5-[(3S)-piperidin-3-yl]pyrazol-1-yl]acetyl]amino]ethyl]benzamide |
| SMILES | O=C(Cn1nccc1[C@H]1CCCNC1)NCCNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H24FN5O2/c20-16-5-3-14(4-6-16)19(27)23-11-10-22-18(26)13-25-17(7-9-24-25)15-2-1-8-21-12-15/h3-7,9,15,21H,1-2,8,10-13H2,(H,22,26)(H,23,27)/t15-/m0/s1 |
| InChIKey | NOPLRCLYDOPVTO-HNNXBMFYSA-N |
| XLogP | 1.04 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|