C16H23Cl2N5O — CID 154905968
2-(5-piperidin-3-ylpyrazol-1-yl)-N-(pyridin-3-ylmethyl)acetamide;dihydrochloride (PubChem CID 154905968) has the molecular formula C16H23Cl2N5O and a molecular weight of 372.30 g/mol. Its IUPAC name is 2-(5-piperidin-3-ylpyrazol-1-yl)-N-(pyridin-3-ylmethyl)acetamide;dihydrochloride.
| Compound Name | 2-(5-piperidin-3-ylpyrazol-1-yl)-N-(pyridin-3-ylmethyl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 154905968 |
| Molecular Formula | C16H23Cl2N5O |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2-(5-piperidin-3-ylpyrazol-1-yl)-N-(pyridin-3-ylmethyl)acetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Cn1nccc1C1CCCNC1)NCc1cccnc1 |
| InChI | InChI=1S/C16H21N5O.2ClH/c22-16(19-10-13-3-1-6-17-9-13)12-21-15(5-8-20-21)14-4-2-7-18-11-14;;/h1,3,5-6,8-9,14,18H,2,4,7,10-12H2,(H,19,22);2*1H |
| InChIKey | VGIHPXXDJHWAIN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |