C17H23N5O — CID 126437725
2-[5-[(3S)-piperidin-3-yl]pyrazol-1-yl]-N-(2-pyridin-3-ylethyl)acetamide (PubChem CID 126437725) has the molecular formula C17H23N5O and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-[5-[(3S)-piperidin-3-yl]pyrazol-1-yl]-N-(2-pyridin-3-ylethyl)acetamide.
| Compound Name | 2-[5-[(3S)-piperidin-3-yl]pyrazol-1-yl]-N-(2-pyridin-3-ylethyl)acetamide |
|---|---|
| PubChem CID | 126437725 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 2-[5-[(3S)-piperidin-3-yl]pyrazol-1-yl]-N-(2-pyridin-3-ylethyl)acetamide |
| SMILES | O=C(Cn1nccc1[C@H]1CCCNC1)NCCc1cccnc1 |
| InChI | InChI=1S/C17H23N5O/c23-17(20-9-5-14-3-1-7-18-11-14)13-22-16(6-10-21-22)15-4-2-8-19-12-15/h1,3,6-7,10-11,15,19H,2,4-5,8-9,12-13H2,(H,20,23)/t15-/m0/s1 |
| InChIKey | JXHIISRCMUGTPS-HNNXBMFYSA-N |
| XLogP | 1.10 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |