C21H29N5O — CID 126454273
N-[3-(2,3-dihydroindol-1-yl)propyl]-2-[5-[(3S)-piperidin-3-yl]pyrazol-1-yl]acetamide (PubChem CID 126454273) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is N-[3-(2,3-dihydroindol-1-yl)propyl]-2-[5-[(3S)-piperidin-3-yl]pyrazol-1-yl]acetamide.
| Compound Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-2-[5-[(3S)-piperidin-3-yl]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 126454273 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | N-[3-(2,3-dihydroindol-1-yl)propyl]-2-[5-[(3S)-piperidin-3-yl]pyrazol-1-yl]acetamide |
| SMILES | O=C(Cn1nccc1[C@H]1CCCNC1)NCCCN1CCc2ccccc21 |
| InChI | InChI=1S/C21H29N5O/c27-21(16-26-20(8-12-24-26)18-6-3-10-22-15-18)23-11-4-13-25-14-9-17-5-1-2-7-19(17)25/h1-2,5,7-8,12,18,22H,3-4,6,9-11,13-16H2,(H,23,27)/t18-/m0/s1 |
| InChIKey | TXQODIOZTBBWIK-SFHVURJKSA-N |
| XLogP | 1.92 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|