C13H22N4O — CID 97456255
(4R)-N-[(2,5-dimethylpyrazol-3-yl)methyl]azepane-4-carboxamide (PubChem CID 97456255) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is (4R)-N-[(2,5-dimethylpyrazol-3-yl)methyl]azepane-4-carboxamide.
| Compound Name | (4R)-N-[(2,5-dimethylpyrazol-3-yl)methyl]azepane-4-carboxamide |
|---|---|
| PubChem CID | 97456255 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | (4R)-N-[(2,5-dimethylpyrazol-3-yl)methyl]azepane-4-carboxamide |
| SMILES | Cc1cc(CNC(=O)[C@@H]2CCCNCC2)n(C)n1 |
| InChI | InChI=1S/C13H22N4O/c1-10-8-12(17(2)16-10)9-15-13(18)11-4-3-6-14-7-5-11/h8,11,14H,3-7,9H2,1-2H3,(H,15,18)/t11-/m1/s1 |
| InChIKey | MVYAPCQRAZDWDO-LLVKDONJSA-N |
| XLogP | 0.73 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |