C14H19F3N4O — CID 122562699
N-[[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]methyl]azepane-4-carboxamide (PubChem CID 122562699) has the molecular formula C14H19F3N4O and a molecular weight of 316.33 g/mol. Its IUPAC name is N-[[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]methyl]azepane-4-carboxamide.
| Compound Name | N-[[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]methyl]azepane-4-carboxamide |
|---|---|
| PubChem CID | 122562699 |
| Molecular Formula | C14H19F3N4O |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | N-[[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]methyl]azepane-4-carboxamide |
| SMILES | Cc1cc(C(F)(F)F)nc(CNC(=O)C2CCCNCC2)n1 |
| InChI | InChI=1S/C14H19F3N4O/c1-9-7-11(14(15,16)17)21-12(20-9)8-19-13(22)10-3-2-5-18-6-4-10/h7,10,18H,2-6,8H2,1H3,(H,19,22) |
| InChIKey | LEYMMPDIZZXWDA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |