C12H15ClN2O2 — CID 86319361
[(3R)-piperidin-3-yl]methyl 4-chloropyridine-2-carboxylate (PubChem CID 86319361) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is [(3R)-piperidin-3-yl]methyl 4-chloropyridine-2-carboxylate.
| Compound Name | [(3R)-piperidin-3-yl]methyl 4-chloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 86319361 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | [(3R)-piperidin-3-yl]methyl 4-chloropyridine-2-carboxylate |
| SMILES | O=C(OC[C@@H]1CCCNC1)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C12H15ClN2O2/c13-10-3-5-15-11(6-10)12(16)17-8-9-2-1-4-14-7-9/h3,5-6,9,14H,1-2,4,7-8H2/t9-/m1/s1 |
| InChIKey | UTKLRUIYCNFSRV-SECBINFHSA-N |
| XLogP | 1.89 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |