About piperidin-3-ylmethyl 4-chloropyridine-2-carboxylate;hydrochloride
piperidin-3-ylmethyl 4-chloropyridine-2-carboxylate;hydrochloride (PubChem CID 53409799) has the molecular formula C12H16Cl2N2O2
and a molecular weight of 291.18 g/mol. Its IUPAC name is piperidin-3-ylmethyl 4-chloropyridine-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | piperidin-3-ylmethyl 4-chloropyridine-2-carboxylate;hydrochloride |
| PubChem CID | 53409799 |
| Molecular Formula | C12H16Cl2N2O2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | piperidin-3-ylmethyl 4-chloropyridine-2-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCC1CCCNC1)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C12H15ClN2O2.ClH/c13-10-3-5-15-11(6-10)12(16)17-8-9-2-1-4-14-7-9;/h3,5-6,9,14H,1-2,4,7-8H2;1H |
| InChIKey | WRPJRMAONZAMPW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperidin-3-ylmethyl 4-chloropyridine-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-3-ylmethyl 4-chloropyridine-2-carboxylate;hydrochloride?
The IUPAC name of piperidin-3-ylmethyl 4-chloropyridine-2-carboxylate;hydrochloride (CID 53409799) is piperidin-3-ylmethyl 4-chloropyridine-2-carboxylate;hydrochloride.
What is the SMILES notation for piperidin-3-ylmethyl 4-chloropyridine-2-carboxylate;hydrochloride?
The canonical SMILES for piperidin-3-ylmethyl 4-chloropyridine-2-carboxylate;hydrochloride is Cl.O=C(OCC1CCCNC1)c1cc(Cl)ccn1.
What is the InChIKey of piperidin-3-ylmethyl 4-chloropyridine-2-carboxylate;hydrochloride?
The InChIKey is WRPJRMAONZAMPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN2O2.ClH/c13-10-3-5-15-11(6-10)12(16)17-8-9-2-1-4-14-7-9;/h3,5-6,9,14H,1-2,4,7-8H2;1H.
What are the key properties of piperidin-3-ylmethyl 4-chloropyridine-2-carboxylate;hydrochloride?
piperidin-3-ylmethyl 4-chloropyridine-2-carboxylate;hydrochloride has a molecular weight of 291.18 g/mol, XLogP of 2.31, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-3-ylmethyl 4-chloropyridine-2-carboxylate;hydrochloride is sourced from PubChem (CID 53409799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).