About azetidin-3-yl pyridine-2-carboxylate
azetidin-3-yl pyridine-2-carboxylate (PubChem CID 130016226) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is azetidin-3-yl pyridine-2-carboxylate.
Molecular Properties
| Compound Name | azetidin-3-yl pyridine-2-carboxylate |
| PubChem CID | 130016226 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | azetidin-3-yl pyridine-2-carboxylate |
| SMILES | O=C(OC1CNC1)c1ccccn1 |
| InChI | InChI=1S/C9H10N2O2/c12-9(13-7-5-10-6-7)8-3-1-2-4-11-8/h1-4,7,10H,5-6H2 |
| InChIKey | MPNOXDCPUYOHFY-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azetidin-3-yl pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-3-yl pyridine-2-carboxylate?
The IUPAC name of azetidin-3-yl pyridine-2-carboxylate (CID 130016226) is azetidin-3-yl pyridine-2-carboxylate.
What is the SMILES notation for azetidin-3-yl pyridine-2-carboxylate?
The canonical SMILES for azetidin-3-yl pyridine-2-carboxylate is O=C(OC1CNC1)c1ccccn1.
What is the InChIKey of azetidin-3-yl pyridine-2-carboxylate?
The InChIKey is MPNOXDCPUYOHFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c12-9(13-7-5-10-6-7)8-3-1-2-4-11-8/h1-4,7,10H,5-6H2.
What are the key properties of azetidin-3-yl pyridine-2-carboxylate?
azetidin-3-yl pyridine-2-carboxylate has a molecular weight of 178.19 g/mol, XLogP of 0.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-3-yl pyridine-2-carboxylate is sourced from PubChem (CID 130016226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).