About piperazin-1-yl pyridine-2-carboxylate;dihydrochloride
piperazin-1-yl pyridine-2-carboxylate;dihydrochloride (PubChem CID 177001655) has the molecular formula C10H15Cl2N3O2
and a molecular weight of 280.15 g/mol. Its IUPAC name is piperazin-1-yl pyridine-2-carboxylate;dihydrochloride.
Molecular Properties
| Compound Name | piperazin-1-yl pyridine-2-carboxylate;dihydrochloride |
| PubChem CID | 177001655 |
| Molecular Formula | C10H15Cl2N3O2 |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | piperazin-1-yl pyridine-2-carboxylate;dihydrochloride |
| SMILES | Cl.Cl.O=C(ON1CCNCC1)c1ccccn1 |
| InChI | InChI=1S/C10H13N3O2.2ClH/c14-10(9-3-1-2-4-12-9)15-13-7-5-11-6-8-13;;/h1-4,11H,5-8H2;2*1H |
| InChIKey | WGOHVFKKOSLRAK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze piperazin-1-yl pyridine-2-carboxylate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazin-1-yl pyridine-2-carboxylate;dihydrochloride?
The IUPAC name of piperazin-1-yl pyridine-2-carboxylate;dihydrochloride (CID 177001655) is piperazin-1-yl pyridine-2-carboxylate;dihydrochloride.
What is the SMILES notation for piperazin-1-yl pyridine-2-carboxylate;dihydrochloride?
The canonical SMILES for piperazin-1-yl pyridine-2-carboxylate;dihydrochloride is Cl.Cl.O=C(ON1CCNCC1)c1ccccn1.
What is the InChIKey of piperazin-1-yl pyridine-2-carboxylate;dihydrochloride?
The InChIKey is WGOHVFKKOSLRAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O2.2ClH/c14-10(9-3-1-2-4-12-9)15-13-7-5-11-6-8-13;;/h1-4,11H,5-8H2;2*1H.
What are the key properties of piperazin-1-yl pyridine-2-carboxylate;dihydrochloride?
piperazin-1-yl pyridine-2-carboxylate;dihydrochloride has a molecular weight of 280.15 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for piperazin-1-yl pyridine-2-carboxylate;dihydrochloride is sourced from PubChem (CID 177001655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).