About pyrrolidin-1-yl pyridine-2-carboxylate
pyrrolidin-1-yl pyridine-2-carboxylate (PubChem CID 118695121) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is pyrrolidin-1-yl pyridine-2-carboxylate.
Molecular Properties
| Compound Name | pyrrolidin-1-yl pyridine-2-carboxylate |
| PubChem CID | 118695121 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | pyrrolidin-1-yl pyridine-2-carboxylate |
| SMILES | O=C(ON1CCCC1)c1ccccn1 |
| InChI | InChI=1S/C10H12N2O2/c13-10(9-5-1-2-6-11-9)14-12-7-3-4-8-12/h1-2,5-6H,3-4,7-8H2 |
| InChIKey | YRFJBEUEXVSTOD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrrolidin-1-yl pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-1-yl pyridine-2-carboxylate?
The IUPAC name of pyrrolidin-1-yl pyridine-2-carboxylate (CID 118695121) is pyrrolidin-1-yl pyridine-2-carboxylate.
What is the SMILES notation for pyrrolidin-1-yl pyridine-2-carboxylate?
The canonical SMILES for pyrrolidin-1-yl pyridine-2-carboxylate is O=C(ON1CCCC1)c1ccccn1.
What is the InChIKey of pyrrolidin-1-yl pyridine-2-carboxylate?
The InChIKey is YRFJBEUEXVSTOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c13-10(9-5-1-2-6-11-9)14-12-7-3-4-8-12/h1-2,5-6H,3-4,7-8H2.
What are the key properties of pyrrolidin-1-yl pyridine-2-carboxylate?
pyrrolidin-1-yl pyridine-2-carboxylate has a molecular weight of 192.22 g/mol, XLogP of 1.25, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-1-yl pyridine-2-carboxylate is sourced from PubChem (CID 118695121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).