About morpholin-4-ylmethyl pyridine-2-carboxylate
morpholin-4-ylmethyl pyridine-2-carboxylate (PubChem CID 67423863) has the molecular formula C11H14N2O3
and a molecular weight of 222.24 g/mol. Its IUPAC name is morpholin-4-ylmethyl pyridine-2-carboxylate.
Molecular Properties
| Compound Name | morpholin-4-ylmethyl pyridine-2-carboxylate |
| PubChem CID | 67423863 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | morpholin-4-ylmethyl pyridine-2-carboxylate |
| SMILES | O=C(OCN1CCOCC1)c1ccccn1 |
| InChI | InChI=1S/C11H14N2O3/c14-11(10-3-1-2-4-12-10)16-9-13-5-7-15-8-6-13/h1-4H,5-9H2 |
| InChIKey | SRZXRXOKKZAXGL-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze morpholin-4-ylmethyl pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-4-ylmethyl pyridine-2-carboxylate?
The IUPAC name of morpholin-4-ylmethyl pyridine-2-carboxylate (CID 67423863) is morpholin-4-ylmethyl pyridine-2-carboxylate.
What is the SMILES notation for morpholin-4-ylmethyl pyridine-2-carboxylate?
The canonical SMILES for morpholin-4-ylmethyl pyridine-2-carboxylate is O=C(OCN1CCOCC1)c1ccccn1.
What is the InChIKey of morpholin-4-ylmethyl pyridine-2-carboxylate?
The InChIKey is SRZXRXOKKZAXGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O3/c14-11(10-3-1-2-4-12-10)16-9-13-5-7-15-8-6-13/h1-4H,5-9H2.
What are the key properties of morpholin-4-ylmethyl pyridine-2-carboxylate?
morpholin-4-ylmethyl pyridine-2-carboxylate has a molecular weight of 222.24 g/mol, XLogP of 0.53, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-4-ylmethyl pyridine-2-carboxylate is sourced from PubChem (CID 67423863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).