About (2-amino-2-pyridin-2-ylethyl) pyridine-2-carboxylate;hydrochloride
(2-amino-2-pyridin-2-ylethyl) pyridine-2-carboxylate;hydrochloride (PubChem CID 174448756) has the molecular formula C13H14ClN3O2
and a molecular weight of 279.73 g/mol. Its IUPAC name is (2-amino-2-pyridin-2-ylethyl) pyridine-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | (2-amino-2-pyridin-2-ylethyl) pyridine-2-carboxylate;hydrochloride |
| PubChem CID | 174448756 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | (2-amino-2-pyridin-2-ylethyl) pyridine-2-carboxylate;hydrochloride |
| SMILES | Cl.NC(COC(=O)c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C13H13N3O2.ClH/c14-10(11-5-1-3-7-15-11)9-18-13(17)12-6-2-4-8-16-12;/h1-8,10H,9,14H2;1H |
| InChIKey | NGCPPYAIYAMVML-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-amino-2-pyridin-2-ylethyl) pyridine-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-2-pyridin-2-ylethyl) pyridine-2-carboxylate;hydrochloride?
The IUPAC name of (2-amino-2-pyridin-2-ylethyl) pyridine-2-carboxylate;hydrochloride (CID 174448756) is (2-amino-2-pyridin-2-ylethyl) pyridine-2-carboxylate;hydrochloride.
What is the SMILES notation for (2-amino-2-pyridin-2-ylethyl) pyridine-2-carboxylate;hydrochloride?
The canonical SMILES for (2-amino-2-pyridin-2-ylethyl) pyridine-2-carboxylate;hydrochloride is Cl.NC(COC(=O)c1ccccn1)c1ccccn1.
What is the InChIKey of (2-amino-2-pyridin-2-ylethyl) pyridine-2-carboxylate;hydrochloride?
The InChIKey is NGCPPYAIYAMVML-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O2.ClH/c14-10(11-5-1-3-7-15-11)9-18-13(17)12-6-2-4-8-16-12;/h1-8,10H,9,14H2;1H.
What are the key properties of (2-amino-2-pyridin-2-ylethyl) pyridine-2-carboxylate;hydrochloride?
(2-amino-2-pyridin-2-ylethyl) pyridine-2-carboxylate;hydrochloride has a molecular weight of 279.73 g/mol, XLogP of 1.76, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2-pyridin-2-ylethyl) pyridine-2-carboxylate;hydrochloride is sourced from PubChem (CID 174448756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).