About 2-methylpentyl pyridine-2-carboxylate
2-methylpentyl pyridine-2-carboxylate (PubChem CID 150671770) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-methylpentyl pyridine-2-carboxylate.
Molecular Properties
| Compound Name | 2-methylpentyl pyridine-2-carboxylate |
| PubChem CID | 150671770 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-methylpentyl pyridine-2-carboxylate |
| SMILES | CCCC(C)COC(=O)c1ccccn1 |
| InChI | InChI=1S/C12H17NO2/c1-3-6-10(2)9-15-12(14)11-7-4-5-8-13-11/h4-5,7-8,10H,3,6,9H2,1-2H3 |
| InChIKey | JGAIAIWGYSAVQX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylpentyl pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentyl pyridine-2-carboxylate?
The IUPAC name of 2-methylpentyl pyridine-2-carboxylate (CID 150671770) is 2-methylpentyl pyridine-2-carboxylate.
What is the SMILES notation for 2-methylpentyl pyridine-2-carboxylate?
The canonical SMILES for 2-methylpentyl pyridine-2-carboxylate is CCCC(C)COC(=O)c1ccccn1.
What is the InChIKey of 2-methylpentyl pyridine-2-carboxylate?
The InChIKey is JGAIAIWGYSAVQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-3-6-10(2)9-15-12(14)11-7-4-5-8-13-11/h4-5,7-8,10H,3,6,9H2,1-2H3.
What are the key properties of 2-methylpentyl pyridine-2-carboxylate?
2-methylpentyl pyridine-2-carboxylate has a molecular weight of 207.27 g/mol, XLogP of 2.67, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentyl pyridine-2-carboxylate is sourced from PubChem (CID 150671770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).