About 2-methylpentyl 2-sulfanylbenzoate
2-methylpentyl 2-sulfanylbenzoate (PubChem CID 107019144) has the molecular formula C13H18O2S
and a molecular weight of 238.35 g/mol. Its IUPAC name is 2-methylpentyl 2-sulfanylbenzoate.
Molecular Properties
| Compound Name | 2-methylpentyl 2-sulfanylbenzoate |
| PubChem CID | 107019144 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-methylpentyl 2-sulfanylbenzoate |
| SMILES | CCCC(C)COC(=O)c1ccccc1S |
| InChI | InChI=1S/C13H18O2S/c1-3-6-10(2)9-15-13(14)11-7-4-5-8-12(11)16/h4-5,7-8,10,16H,3,6,9H2,1-2H3 |
| InChIKey | ABVZUPJYFKNXQB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpentyl 2-sulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentyl 2-sulfanylbenzoate?
The IUPAC name of 2-methylpentyl 2-sulfanylbenzoate (CID 107019144) is 2-methylpentyl 2-sulfanylbenzoate.
What is the SMILES notation for 2-methylpentyl 2-sulfanylbenzoate?
The canonical SMILES for 2-methylpentyl 2-sulfanylbenzoate is CCCC(C)COC(=O)c1ccccc1S.
What is the InChIKey of 2-methylpentyl 2-sulfanylbenzoate?
The InChIKey is ABVZUPJYFKNXQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2S/c1-3-6-10(2)9-15-13(14)11-7-4-5-8-12(11)16/h4-5,7-8,10,16H,3,6,9H2,1-2H3.
What are the key properties of 2-methylpentyl 2-sulfanylbenzoate?
2-methylpentyl 2-sulfanylbenzoate has a molecular weight of 238.35 g/mol, XLogP of 3.57, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentyl 2-sulfanylbenzoate is sourced from PubChem (CID 107019144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).