About 2-methylbutyl 2-ethylbenzoate
2-methylbutyl 2-ethylbenzoate (PubChem CID 175585284) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 2-methylbutyl 2-ethylbenzoate.
Molecular Properties
| Compound Name | 2-methylbutyl 2-ethylbenzoate |
| PubChem CID | 175585284 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 2-methylbutyl 2-ethylbenzoate |
| SMILES | CCc1ccccc1C(=O)OCC(C)CC |
| InChI | InChI=1S/C14H20O2/c1-4-11(3)10-16-14(15)13-9-7-6-8-12(13)5-2/h6-9,11H,4-5,10H2,1-3H3 |
| InChIKey | IECDRAIQWZIFII-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylbutyl 2-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutyl 2-ethylbenzoate?
The IUPAC name of 2-methylbutyl 2-ethylbenzoate (CID 175585284) is 2-methylbutyl 2-ethylbenzoate.
What is the SMILES notation for 2-methylbutyl 2-ethylbenzoate?
The canonical SMILES for 2-methylbutyl 2-ethylbenzoate is CCc1ccccc1C(=O)OCC(C)CC.
What is the InChIKey of 2-methylbutyl 2-ethylbenzoate?
The InChIKey is IECDRAIQWZIFII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2/c1-4-11(3)10-16-14(15)13-9-7-6-8-12(13)5-2/h6-9,11H,4-5,10H2,1-3H3.
What are the key properties of 2-methylbutyl 2-ethylbenzoate?
2-methylbutyl 2-ethylbenzoate has a molecular weight of 220.31 g/mol, XLogP of 3.45, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutyl 2-ethylbenzoate is sourced from PubChem (CID 175585284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).