About 2-[2-(2-ethylbenzoyl)oxypropoxy]propyl 2-ethylbenzoate
2-[2-(2-ethylbenzoyl)oxypropoxy]propyl 2-ethylbenzoate (PubChem CID 23024581) has the molecular formula C24H30O5
and a molecular weight of 398.50 g/mol. Its IUPAC name is 2-[2-(2-ethylbenzoyl)oxypropoxy]propyl 2-ethylbenzoate.
Molecular Properties
| Compound Name | 2-[2-(2-ethylbenzoyl)oxypropoxy]propyl 2-ethylbenzoate |
| PubChem CID | 23024581 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-[2-(2-ethylbenzoyl)oxypropoxy]propyl 2-ethylbenzoate |
| SMILES | CCc1ccccc1C(=O)OCC(C)OCC(C)OC(=O)c1ccccc1CC |
| InChI | InChI=1S/C24H30O5/c1-5-19-11-7-9-13-21(19)23(25)28-15-17(3)27-16-18(4)29-24(26)22-14-10-8-12-20(22)6-2/h7-14,17-18H,5-6,15-16H2,1-4H3 |
| InChIKey | IJXUBWZGLJIGNR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-(2-ethylbenzoyl)oxypropoxy]propyl 2-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-ethylbenzoyl)oxypropoxy]propyl 2-ethylbenzoate?
The IUPAC name of 2-[2-(2-ethylbenzoyl)oxypropoxy]propyl 2-ethylbenzoate (CID 23024581) is 2-[2-(2-ethylbenzoyl)oxypropoxy]propyl 2-ethylbenzoate.
What is the SMILES notation for 2-[2-(2-ethylbenzoyl)oxypropoxy]propyl 2-ethylbenzoate?
The canonical SMILES for 2-[2-(2-ethylbenzoyl)oxypropoxy]propyl 2-ethylbenzoate is CCc1ccccc1C(=O)OCC(C)OCC(C)OC(=O)c1ccccc1CC.
What is the InChIKey of 2-[2-(2-ethylbenzoyl)oxypropoxy]propyl 2-ethylbenzoate?
The InChIKey is IJXUBWZGLJIGNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30O5/c1-5-19-11-7-9-13-21(19)23(25)28-15-17(3)27-16-18(4)29-24(26)22-14-10-8-12-20(22)6-2/h7-14,17-18H,5-6,15-16H2,1-4H3.
What are the key properties of 2-[2-(2-ethylbenzoyl)oxypropoxy]propyl 2-ethylbenzoate?
2-[2-(2-ethylbenzoyl)oxypropoxy]propyl 2-ethylbenzoate has a molecular weight of 398.50 g/mol, XLogP of 4.62, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-ethylbenzoyl)oxypropoxy]propyl 2-ethylbenzoate is sourced from PubChem (CID 23024581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).