About 2-[2-[2-[2-(2-methylbenzoyl)oxypropoxy]propoxy]propoxy]propyl 2-methylbenzoate
2-[2-[2-[2-(2-methylbenzoyl)oxypropoxy]propoxy]propoxy]propyl 2-methylbenzoate (PubChem CID 121375652) has the molecular formula C28H38O7
and a molecular weight of 486.61 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-methylbenzoyl)oxypropoxy]propoxy]propoxy]propyl 2-methylbenzoate.
Molecular Properties
| Compound Name | 2-[2-[2-[2-(2-methylbenzoyl)oxypropoxy]propoxy]propoxy]propyl 2-methylbenzoate |
| PubChem CID | 121375652 |
| Molecular Formula | C28H38O7 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 2-[2-[2-[2-(2-methylbenzoyl)oxypropoxy]propoxy]propoxy]propyl 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)OCC(C)OCC(C)OCC(C)OCC(C)OC(=O)c1ccccc1C |
| InChI | InChI=1S/C28H38O7/c1-19-11-7-9-13-25(19)27(29)34-17-23(5)32-15-21(3)31-16-22(4)33-18-24(6)35-28(30)26-14-10-8-12-20(26)2/h7-14,21-24H,15-18H2,1-6H3 |
| InChIKey | NYPNFVANRPSGRC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[2-[2-[2-(2-methylbenzoyl)oxypropoxy]propoxy]propoxy]propyl 2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-[2-(2-methylbenzoyl)oxypropoxy]propoxy]propoxy]propyl 2-methylbenzoate?
The IUPAC name of 2-[2-[2-[2-(2-methylbenzoyl)oxypropoxy]propoxy]propoxy]propyl 2-methylbenzoate (CID 121375652) is 2-[2-[2-[2-(2-methylbenzoyl)oxypropoxy]propoxy]propoxy]propyl 2-methylbenzoate.
What is the SMILES notation for 2-[2-[2-[2-(2-methylbenzoyl)oxypropoxy]propoxy]propoxy]propyl 2-methylbenzoate?
The canonical SMILES for 2-[2-[2-[2-(2-methylbenzoyl)oxypropoxy]propoxy]propoxy]propyl 2-methylbenzoate is Cc1ccccc1C(=O)OCC(C)OCC(C)OCC(C)OCC(C)OC(=O)c1ccccc1C.
What is the InChIKey of 2-[2-[2-[2-(2-methylbenzoyl)oxypropoxy]propoxy]propoxy]propyl 2-methylbenzoate?
The InChIKey is NYPNFVANRPSGRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H38O7/c1-19-11-7-9-13-25(19)27(29)34-17-23(5)32-15-21(3)31-16-22(4)33-18-24(6)35-28(30)26-14-10-8-12-20(26)2/h7-14,21-24H,15-18H2,1-6H3.
What are the key properties of 2-[2-[2-[2-(2-methylbenzoyl)oxypropoxy]propoxy]propoxy]propyl 2-methylbenzoate?
2-[2-[2-[2-(2-methylbenzoyl)oxypropoxy]propoxy]propoxy]propyl 2-methylbenzoate has a molecular weight of 486.61 g/mol, XLogP of 4.92, 14 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-[2-(2-methylbenzoyl)oxypropoxy]propoxy]propoxy]propyl 2-methylbenzoate is sourced from PubChem (CID 121375652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).