About (2-amino-3-phenylpropyl) 2-methylbenzoate
(2-amino-3-phenylpropyl) 2-methylbenzoate (PubChem CID 162385429) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is (2-amino-3-phenylpropyl) 2-methylbenzoate.
Molecular Properties
| Compound Name | (2-amino-3-phenylpropyl) 2-methylbenzoate |
| PubChem CID | 162385429 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (2-amino-3-phenylpropyl) 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)OCC(N)Cc1ccccc1 |
| InChI | InChI=1S/C17H19NO2/c1-13-7-5-6-10-16(13)17(19)20-12-15(18)11-14-8-3-2-4-9-14/h2-10,15H,11-12,18H2,1H3 |
| InChIKey | SEKAGLYVBKVBHB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-amino-3-phenylpropyl) 2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-3-phenylpropyl) 2-methylbenzoate?
The IUPAC name of (2-amino-3-phenylpropyl) 2-methylbenzoate (CID 162385429) is (2-amino-3-phenylpropyl) 2-methylbenzoate.
What is the SMILES notation for (2-amino-3-phenylpropyl) 2-methylbenzoate?
The canonical SMILES for (2-amino-3-phenylpropyl) 2-methylbenzoate is Cc1ccccc1C(=O)OCC(N)Cc1ccccc1.
What is the InChIKey of (2-amino-3-phenylpropyl) 2-methylbenzoate?
The InChIKey is SEKAGLYVBKVBHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-13-7-5-6-10-16(13)17(19)20-12-15(18)11-14-8-3-2-4-9-14/h2-10,15H,11-12,18H2,1H3.
What are the key properties of (2-amino-3-phenylpropyl) 2-methylbenzoate?
(2-amino-3-phenylpropyl) 2-methylbenzoate has a molecular weight of 269.34 g/mol, XLogP of 2.72, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-3-phenylpropyl) 2-methylbenzoate is sourced from PubChem (CID 162385429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).