C17H21NO — CID 14796882
(2S)-1-(2,6-dimethylphenoxy)-3-phenylpropan-2-amine (PubChem CID 14796882) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is (2S)-1-(2,6-dimethylphenoxy)-3-phenylpropan-2-amine.
| Compound Name | (2S)-1-(2,6-dimethylphenoxy)-3-phenylpropan-2-amine |
|---|---|
| PubChem CID | 14796882 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (2S)-1-(2,6-dimethylphenoxy)-3-phenylpropan-2-amine |
| SMILES | Cc1cccc(C)c1OC[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C17H21NO/c1-13-7-6-8-14(2)17(13)19-12-16(18)11-15-9-4-3-5-10-15/h3-10,16H,11-12,18H2,1-2H3/t16-/m0/s1 |
| InChIKey | ZAEMMWJTFWLIMU-INIZCTEOSA-N |
| XLogP | 3.25 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |