About (2-amino-2-pyridin-4-ylethyl) pyridine-2-carboxylate
(2-amino-2-pyridin-4-ylethyl) pyridine-2-carboxylate (PubChem CID 174416527) has the molecular formula C13H13N3O2
and a molecular weight of 243.27 g/mol. Its IUPAC name is (2-amino-2-pyridin-4-ylethyl) pyridine-2-carboxylate.
Molecular Properties
| Compound Name | (2-amino-2-pyridin-4-ylethyl) pyridine-2-carboxylate |
| PubChem CID | 174416527 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | (2-amino-2-pyridin-4-ylethyl) pyridine-2-carboxylate |
| SMILES | NC(COC(=O)c1ccccn1)c1ccncc1 |
| InChI | InChI=1S/C13H13N3O2/c14-11(10-4-7-15-8-5-10)9-18-13(17)12-3-1-2-6-16-12/h1-8,11H,9,14H2 |
| InChIKey | RWECOAFTFRGQGU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-amino-2-pyridin-4-ylethyl) pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-2-pyridin-4-ylethyl) pyridine-2-carboxylate?
The IUPAC name of (2-amino-2-pyridin-4-ylethyl) pyridine-2-carboxylate (CID 174416527) is (2-amino-2-pyridin-4-ylethyl) pyridine-2-carboxylate.
What is the SMILES notation for (2-amino-2-pyridin-4-ylethyl) pyridine-2-carboxylate?
The canonical SMILES for (2-amino-2-pyridin-4-ylethyl) pyridine-2-carboxylate is NC(COC(=O)c1ccccn1)c1ccncc1.
What is the InChIKey of (2-amino-2-pyridin-4-ylethyl) pyridine-2-carboxylate?
The InChIKey is RWECOAFTFRGQGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O2/c14-11(10-4-7-15-8-5-10)9-18-13(17)12-3-1-2-6-16-12/h1-8,11H,9,14H2.
What are the key properties of (2-amino-2-pyridin-4-ylethyl) pyridine-2-carboxylate?
(2-amino-2-pyridin-4-ylethyl) pyridine-2-carboxylate has a molecular weight of 243.27 g/mol, XLogP of 1.33, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2-pyridin-4-ylethyl) pyridine-2-carboxylate is sourced from PubChem (CID 174416527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).