About 1-aminoethyl pyridine-2-carboxylate
1-aminoethyl pyridine-2-carboxylate (PubChem CID 141264689) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is 1-aminoethyl pyridine-2-carboxylate.
Molecular Properties
| Compound Name | 1-aminoethyl pyridine-2-carboxylate |
| PubChem CID | 141264689 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 1-aminoethyl pyridine-2-carboxylate |
| SMILES | CC(N)OC(=O)c1ccccn1 |
| InChI | InChI=1S/C8H10N2O2/c1-6(9)12-8(11)7-4-2-3-5-10-7/h2-6H,9H2,1H3 |
| InChIKey | BIWRJGDWTKEEBX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethyl pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethyl pyridine-2-carboxylate?
The IUPAC name of 1-aminoethyl pyridine-2-carboxylate (CID 141264689) is 1-aminoethyl pyridine-2-carboxylate.
What is the SMILES notation for 1-aminoethyl pyridine-2-carboxylate?
The canonical SMILES for 1-aminoethyl pyridine-2-carboxylate is CC(N)OC(=O)c1ccccn1.
What is the InChIKey of 1-aminoethyl pyridine-2-carboxylate?
The InChIKey is BIWRJGDWTKEEBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-6(9)12-8(11)7-4-2-3-5-10-7/h2-6H,9H2,1H3.
What are the key properties of 1-aminoethyl pyridine-2-carboxylate?
1-aminoethyl pyridine-2-carboxylate has a molecular weight of 166.18 g/mol, XLogP of 0.54, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethyl pyridine-2-carboxylate is sourced from PubChem (CID 141264689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).