About 4-tri(propan-2-yl)silyloxybutan-2-yl pyridine-2-carboxylate
4-tri(propan-2-yl)silyloxybutan-2-yl pyridine-2-carboxylate (PubChem CID 100987019) has the molecular formula C19H33NO3Si
and a molecular weight of 351.56 g/mol. Its IUPAC name is 4-tri(propan-2-yl)silyloxybutan-2-yl pyridine-2-carboxylate.
Molecular Properties
| Compound Name | 4-tri(propan-2-yl)silyloxybutan-2-yl pyridine-2-carboxylate |
| PubChem CID | 100987019 |
| Molecular Formula | C19H33NO3Si |
| Molecular Weight | 351.56 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 4-tri(propan-2-yl)silyloxybutan-2-yl pyridine-2-carboxylate |
| SMILES | CC(CCO[Si](C(C)C)(C(C)C)C(C)C)OC(=O)c1ccccn1 |
| InChI | InChI=1S/C19H33NO3Si/c1-14(2)24(15(3)4,16(5)6)22-13-11-17(7)23-19(21)18-10-8-9-12-20-18/h8-10,12,14-17H,11,13H2,1-7H3 |
| InChIKey | JQTREBMFNNHZSX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-tri(propan-2-yl)silyloxybutan-2-yl pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tri(propan-2-yl)silyloxybutan-2-yl pyridine-2-carboxylate?
The IUPAC name of 4-tri(propan-2-yl)silyloxybutan-2-yl pyridine-2-carboxylate (CID 100987019) is 4-tri(propan-2-yl)silyloxybutan-2-yl pyridine-2-carboxylate.
What is the SMILES notation for 4-tri(propan-2-yl)silyloxybutan-2-yl pyridine-2-carboxylate?
The canonical SMILES for 4-tri(propan-2-yl)silyloxybutan-2-yl pyridine-2-carboxylate is CC(CCO[Si](C(C)C)(C(C)C)C(C)C)OC(=O)c1ccccn1.
What is the InChIKey of 4-tri(propan-2-yl)silyloxybutan-2-yl pyridine-2-carboxylate?
The InChIKey is JQTREBMFNNHZSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33NO3Si/c1-14(2)24(15(3)4,16(5)6)22-13-11-17(7)23-19(21)18-10-8-9-12-20-18/h8-10,12,14-17H,11,13H2,1-7H3.
What are the key properties of 4-tri(propan-2-yl)silyloxybutan-2-yl pyridine-2-carboxylate?
4-tri(propan-2-yl)silyloxybutan-2-yl pyridine-2-carboxylate has a molecular weight of 351.56 g/mol, XLogP of 5.21, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tri(propan-2-yl)silyloxybutan-2-yl pyridine-2-carboxylate is sourced from PubChem (CID 100987019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).