C17H17NO2 — CID 101499826
[(E,2R)-4-(4-methylphenyl)but-3-en-2-yl] pyridine-2-carboxylate (PubChem CID 101499826) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is [(E,2R)-4-(4-methylphenyl)but-3-en-2-yl] pyridine-2-carboxylate.
| Compound Name | [(E,2R)-4-(4-methylphenyl)but-3-en-2-yl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 101499826 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | [(E,2R)-4-(4-methylphenyl)but-3-en-2-yl] pyridine-2-carboxylate |
| SMILES | Cc1ccc(/C=C/[C@@H](C)OC(=O)c2ccccn2)cc1 |
| InChI | InChI=1S/C17H17NO2/c1-13-6-9-15(10-7-13)11-8-14(2)20-17(19)16-5-3-4-12-18-16/h3-12,14H,1-2H3/b11-8+/t14-/m1/s1 |
| InChIKey | UIWYUKGXIHXQSS-BMGYJQCNSA-N |
| XLogP | 3.65 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |