About [(E,2R)-4-(4-methylphenyl)but-3-en-2-yl] pyridine-2-carboxylate
[(E,2R)-4-(4-methylphenyl)but-3-en-2-yl] pyridine-2-carboxylate (PubChem CID 101499826) has the molecular formula C17H17NO2
and a molecular weight of 267.33 g/mol. Its IUPAC name is [(E,2R)-4-(4-methylphenyl)but-3-en-2-yl] pyridine-2-carboxylate.
Molecular Properties
| Compound Name | [(E,2R)-4-(4-methylphenyl)but-3-en-2-yl] pyridine-2-carboxylate |
| PubChem CID | 101499826 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | [(E,2R)-4-(4-methylphenyl)but-3-en-2-yl] pyridine-2-carboxylate |
| SMILES | Cc1ccc(/C=C/[C@@H](C)OC(=O)c2ccccn2)cc1 |
| InChI | InChI=1S/C17H17NO2/c1-13-6-9-15(10-7-13)11-8-14(2)20-17(19)16-5-3-4-12-18-16/h3-12,14H,1-2H3/b11-8+/t14-/m1/s1 |
| InChIKey | UIWYUKGXIHXQSS-BMGYJQCNSA-N |
| XLogP | 3.65 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(E,2R)-4-(4-methylphenyl)but-3-en-2-yl] pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,2R)-4-(4-methylphenyl)but-3-en-2-yl] pyridine-2-carboxylate?
The IUPAC name of [(E,2R)-4-(4-methylphenyl)but-3-en-2-yl] pyridine-2-carboxylate (CID 101499826) is [(E,2R)-4-(4-methylphenyl)but-3-en-2-yl] pyridine-2-carboxylate.
What is the SMILES notation for [(E,2R)-4-(4-methylphenyl)but-3-en-2-yl] pyridine-2-carboxylate?
The canonical SMILES for [(E,2R)-4-(4-methylphenyl)but-3-en-2-yl] pyridine-2-carboxylate is Cc1ccc(/C=C/[C@@H](C)OC(=O)c2ccccn2)cc1.
What is the InChIKey of [(E,2R)-4-(4-methylphenyl)but-3-en-2-yl] pyridine-2-carboxylate?
The InChIKey is UIWYUKGXIHXQSS-BMGYJQCNSA-N. The full InChI is InChI=1S/C17H17NO2/c1-13-6-9-15(10-7-13)11-8-14(2)20-17(19)16-5-3-4-12-18-16/h3-12,14H,1-2H3/b11-8+/t14-/m1/s1.
What are the key properties of [(E,2R)-4-(4-methylphenyl)but-3-en-2-yl] pyridine-2-carboxylate?
[(E,2R)-4-(4-methylphenyl)but-3-en-2-yl] pyridine-2-carboxylate has a molecular weight of 267.33 g/mol, XLogP of 3.65, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,2R)-4-(4-methylphenyl)but-3-en-2-yl] pyridine-2-carboxylate is sourced from PubChem (CID 101499826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).