About (4-fluorobenzoyl) pyridine-2-carboxylate
(4-fluorobenzoyl) pyridine-2-carboxylate (PubChem CID 154414835) has the molecular formula C13H8FNO3
and a molecular weight of 245.21 g/mol. Its IUPAC name is (4-fluorobenzoyl) pyridine-2-carboxylate.
Molecular Properties
| Compound Name | (4-fluorobenzoyl) pyridine-2-carboxylate |
| PubChem CID | 154414835 |
| Molecular Formula | C13H8FNO3 |
| Molecular Weight | 245.21 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | (4-fluorobenzoyl) pyridine-2-carboxylate |
| SMILES | O=C(OC(=O)c1ccccn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H8FNO3/c14-10-6-4-9(5-7-10)12(16)18-13(17)11-3-1-2-8-15-11/h1-8H |
| InChIKey | VWRGXVQMCOMVKI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (4-fluorobenzoyl) pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorobenzoyl) pyridine-2-carboxylate?
The IUPAC name of (4-fluorobenzoyl) pyridine-2-carboxylate (CID 154414835) is (4-fluorobenzoyl) pyridine-2-carboxylate.
What is the SMILES notation for (4-fluorobenzoyl) pyridine-2-carboxylate?
The canonical SMILES for (4-fluorobenzoyl) pyridine-2-carboxylate is O=C(OC(=O)c1ccccn1)c1ccc(F)cc1.
What is the InChIKey of (4-fluorobenzoyl) pyridine-2-carboxylate?
The InChIKey is VWRGXVQMCOMVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8FNO3/c14-10-6-4-9(5-7-10)12(16)18-13(17)11-3-1-2-8-15-11/h1-8H.
What are the key properties of (4-fluorobenzoyl) pyridine-2-carboxylate?
(4-fluorobenzoyl) pyridine-2-carboxylate has a molecular weight of 245.21 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorobenzoyl) pyridine-2-carboxylate is sourced from PubChem (CID 154414835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).