About pyridine-2-carbothioic S-acid
pyridine-2-carbothioic S-acid (PubChem CID 158789814) has the molecular formula C12H10N2O2S2
and a molecular weight of 278.36 g/mol. Its IUPAC name is pyridine-2-carbothioic S-acid.
Molecular Properties
| Compound Name | pyridine-2-carbothioic S-acid |
| PubChem CID | 158789814 |
| Molecular Formula | C12H10N2O2S2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | pyridine-2-carbothioic S-acid |
| SMILES | O=C(S)c1ccccn1.O=C(S)c1ccccn1 |
| InChI | InChI=1S/2C6H5NOS/c2*8-6(9)5-3-1-2-4-7-5/h2*1-4H,(H,8,9) |
| InChIKey | ISDAPAXNBMFVEV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze pyridine-2-carbothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-2-carbothioic S-acid?
The IUPAC name of pyridine-2-carbothioic S-acid (CID 158789814) is pyridine-2-carbothioic S-acid.
What is the SMILES notation for pyridine-2-carbothioic S-acid?
The canonical SMILES for pyridine-2-carbothioic S-acid is O=C(S)c1ccccn1.O=C(S)c1ccccn1.
What is the InChIKey of pyridine-2-carbothioic S-acid?
The InChIKey is ISDAPAXNBMFVEV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5NOS/c2*8-6(9)5-3-1-2-4-7-5/h2*1-4H,(H,8,9).
What are the key properties of pyridine-2-carbothioic S-acid?
pyridine-2-carbothioic S-acid has a molecular weight of 278.36 g/mol, XLogP of 2.30, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-2-carbothioic S-acid is sourced from PubChem (CID 158789814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).