About europium(3+);pyridine-2-carboxylate
europium(3+);pyridine-2-carboxylate (PubChem CID 172810679) has the molecular formula C6H4EuNO2+2
and a molecular weight of 274.07 g/mol. Its IUPAC name is europium(3+);pyridine-2-carboxylate.
Molecular Properties
| Compound Name | europium(3+);pyridine-2-carboxylate |
| PubChem CID | 172810679 |
| Molecular Formula | C6H4EuNO2+2 |
| Molecular Weight | 274.07 g/mol |
| Exact Mass | 274.94 |
| IUPAC Name | europium(3+);pyridine-2-carboxylate |
| SMILES | O=C([O-])c1ccccn1.[Eu+3] |
| InChI | InChI=1S/C6H5NO2.Eu/c8-6(9)5-3-1-2-4-7-5;/h1-4H,(H,8,9);/q;+3/p-1 |
| InChIKey | SDBCOOLMAMVEHT-UHFFFAOYSA-M |
| XLogP | -0.55 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.07 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze europium(3+);pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of europium(3+);pyridine-2-carboxylate?
The IUPAC name of europium(3+);pyridine-2-carboxylate (CID 172810679) is europium(3+);pyridine-2-carboxylate.
What is the SMILES notation for europium(3+);pyridine-2-carboxylate?
The canonical SMILES for europium(3+);pyridine-2-carboxylate is O=C([O-])c1ccccn1.[Eu+3].
What is the InChIKey of europium(3+);pyridine-2-carboxylate?
The InChIKey is SDBCOOLMAMVEHT-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5NO2.Eu/c8-6(9)5-3-1-2-4-7-5;/h1-4H,(H,8,9);/q;+3/p-1.
What are the key properties of europium(3+);pyridine-2-carboxylate?
europium(3+);pyridine-2-carboxylate has a molecular weight of 274.07 g/mol, XLogP of -0.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for europium(3+);pyridine-2-carboxylate is sourced from PubChem (CID 172810679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).