About dimethylazanium;pyridine-2-carboxylate
dimethylazanium;pyridine-2-carboxylate (PubChem CID 67178639) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is dimethylazanium;pyridine-2-carboxylate.
Molecular Properties
| Compound Name | dimethylazanium;pyridine-2-carboxylate |
| PubChem CID | 67178639 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | dimethylazanium;pyridine-2-carboxylate |
| SMILES | C[NH2+]C.O=C([O-])c1ccccn1 |
| InChI | InChI=1S/C6H5NO2.C2H7N/c8-6(9)5-3-1-2-4-7-5;1-3-2/h1-4H,(H,8,9);3H,1-2H3 |
| InChIKey | MMUFWVCXNKBJEM-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 69.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dimethylazanium;pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylazanium;pyridine-2-carboxylate?
The IUPAC name of dimethylazanium;pyridine-2-carboxylate (CID 67178639) is dimethylazanium;pyridine-2-carboxylate.
What is the SMILES notation for dimethylazanium;pyridine-2-carboxylate?
The canonical SMILES for dimethylazanium;pyridine-2-carboxylate is C[NH2+]C.O=C([O-])c1ccccn1.
What is the InChIKey of dimethylazanium;pyridine-2-carboxylate?
The InChIKey is MMUFWVCXNKBJEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.C2H7N/c8-6(9)5-3-1-2-4-7-5;1-3-2/h1-4H,(H,8,9);3H,1-2H3.
What are the key properties of dimethylazanium;pyridine-2-carboxylate?
dimethylazanium;pyridine-2-carboxylate has a molecular weight of 168.20 g/mol, XLogP of -1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylazanium;pyridine-2-carboxylate is sourced from PubChem (CID 67178639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).