About 2-pyridin-2-ylethynyl pyridine-2-carboxylate
2-pyridin-2-ylethynyl pyridine-2-carboxylate (PubChem CID 154461322) has the molecular formula C13H8N2O2
and a molecular weight of 224.22 g/mol. Its IUPAC name is 2-pyridin-2-ylethynyl pyridine-2-carboxylate.
Molecular Properties
| Compound Name | 2-pyridin-2-ylethynyl pyridine-2-carboxylate |
| PubChem CID | 154461322 |
| Molecular Formula | C13H8N2O2 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 2-pyridin-2-ylethynyl pyridine-2-carboxylate |
| SMILES | O=C(OC#Cc1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C13H8N2O2/c16-13(12-6-2-4-9-15-12)17-10-7-11-5-1-3-8-14-11/h1-6,8-9H |
| InChIKey | QCCPBFLFCGHBOQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-pyridin-2-ylethynyl pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylethynyl pyridine-2-carboxylate?
The IUPAC name of 2-pyridin-2-ylethynyl pyridine-2-carboxylate (CID 154461322) is 2-pyridin-2-ylethynyl pyridine-2-carboxylate.
What is the SMILES notation for 2-pyridin-2-ylethynyl pyridine-2-carboxylate?
The canonical SMILES for 2-pyridin-2-ylethynyl pyridine-2-carboxylate is O=C(OC#Cc1ccccn1)c1ccccn1.
What is the InChIKey of 2-pyridin-2-ylethynyl pyridine-2-carboxylate?
The InChIKey is QCCPBFLFCGHBOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O2/c16-13(12-6-2-4-9-15-12)17-10-7-11-5-1-3-8-14-11/h1-6,8-9H.
What are the key properties of 2-pyridin-2-ylethynyl pyridine-2-carboxylate?
2-pyridin-2-ylethynyl pyridine-2-carboxylate has a molecular weight of 224.22 g/mol, XLogP of 1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylethynyl pyridine-2-carboxylate is sourced from PubChem (CID 154461322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).