About (triphenyl-λ4-sulfanyl) pyridine-2-carboxylate
(triphenyl-λ4-sulfanyl) pyridine-2-carboxylate (PubChem CID 140714321) has the molecular formula C24H19NO2S
and a molecular weight of 385.49 g/mol. Its IUPAC name is (triphenyl-λ4-sulfanyl) pyridine-2-carboxylate.
Molecular Properties
| Compound Name | (triphenyl-λ4-sulfanyl) pyridine-2-carboxylate |
| PubChem CID | 140714321 |
| Molecular Formula | C24H19NO2S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | (triphenyl-λ4-sulfanyl) pyridine-2-carboxylate |
| SMILES | O=C(OS(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C24H19NO2S/c26-24(23-18-10-11-19-25-23)27-28(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1-19H |
| InChIKey | GEZKZGXLNSUDKD-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (triphenyl-λ4-sulfanyl) pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (triphenyl-λ4-sulfanyl) pyridine-2-carboxylate?
The IUPAC name of (triphenyl-λ4-sulfanyl) pyridine-2-carboxylate (CID 140714321) is (triphenyl-λ4-sulfanyl) pyridine-2-carboxylate.
What is the SMILES notation for (triphenyl-λ4-sulfanyl) pyridine-2-carboxylate?
The canonical SMILES for (triphenyl-λ4-sulfanyl) pyridine-2-carboxylate is O=C(OS(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccn1.
What is the InChIKey of (triphenyl-λ4-sulfanyl) pyridine-2-carboxylate?
The InChIKey is GEZKZGXLNSUDKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19NO2S/c26-24(23-18-10-11-19-25-23)27-28(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1-19H.
What are the key properties of (triphenyl-λ4-sulfanyl) pyridine-2-carboxylate?
(triphenyl-λ4-sulfanyl) pyridine-2-carboxylate has a molecular weight of 385.49 g/mol, XLogP of 6.14, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (triphenyl-λ4-sulfanyl) pyridine-2-carboxylate is sourced from PubChem (CID 140714321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).