About piperidin-4-ylmethyl pyridine-4-carboxylate;hydrochloride
piperidin-4-ylmethyl pyridine-4-carboxylate;hydrochloride (PubChem CID 53410155) has the molecular formula C12H17ClN2O2
and a molecular weight of 256.73 g/mol. Its IUPAC name is piperidin-4-ylmethyl pyridine-4-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | piperidin-4-ylmethyl pyridine-4-carboxylate;hydrochloride |
| PubChem CID | 53410155 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | piperidin-4-ylmethyl pyridine-4-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCC1CCNCC1)c1ccncc1 |
| InChI | InChI=1S/C12H16N2O2.ClH/c15-12(11-3-7-14-8-4-11)16-9-10-1-5-13-6-2-10;/h3-4,7-8,10,13H,1-2,5-6,9H2;1H |
| InChIKey | APXFKDSFESBFQE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperidin-4-ylmethyl pyridine-4-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-ylmethyl pyridine-4-carboxylate;hydrochloride?
The IUPAC name of piperidin-4-ylmethyl pyridine-4-carboxylate;hydrochloride (CID 53410155) is piperidin-4-ylmethyl pyridine-4-carboxylate;hydrochloride.
What is the SMILES notation for piperidin-4-ylmethyl pyridine-4-carboxylate;hydrochloride?
The canonical SMILES for piperidin-4-ylmethyl pyridine-4-carboxylate;hydrochloride is Cl.O=C(OCC1CCNCC1)c1ccncc1.
What is the InChIKey of piperidin-4-ylmethyl pyridine-4-carboxylate;hydrochloride?
The InChIKey is APXFKDSFESBFQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2.ClH/c15-12(11-3-7-14-8-4-11)16-9-10-1-5-13-6-2-10;/h3-4,7-8,10,13H,1-2,5-6,9H2;1H.
What are the key properties of piperidin-4-ylmethyl pyridine-4-carboxylate;hydrochloride?
piperidin-4-ylmethyl pyridine-4-carboxylate;hydrochloride has a molecular weight of 256.73 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-ylmethyl pyridine-4-carboxylate;hydrochloride is sourced from PubChem (CID 53410155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).