About piperidin-4-ylmethyl naphthalene-1-carboxylate;hydrochloride
piperidin-4-ylmethyl naphthalene-1-carboxylate;hydrochloride (PubChem CID 68534065) has the molecular formula C17H20ClNO2
and a molecular weight of 305.80 g/mol. Its IUPAC name is piperidin-4-ylmethyl naphthalene-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | piperidin-4-ylmethyl naphthalene-1-carboxylate;hydrochloride |
| PubChem CID | 68534065 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.80 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | piperidin-4-ylmethyl naphthalene-1-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCC1CCNCC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H19NO2.ClH/c19-17(20-12-13-8-10-18-11-9-13)16-7-3-5-14-4-1-2-6-15(14)16;/h1-7,13,18H,8-12H2;1H |
| InChIKey | UISXUORJVPUTJJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.80 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidin-4-ylmethyl naphthalene-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-ylmethyl naphthalene-1-carboxylate;hydrochloride?
The IUPAC name of piperidin-4-ylmethyl naphthalene-1-carboxylate;hydrochloride (CID 68534065) is piperidin-4-ylmethyl naphthalene-1-carboxylate;hydrochloride.
What is the SMILES notation for piperidin-4-ylmethyl naphthalene-1-carboxylate;hydrochloride?
The canonical SMILES for piperidin-4-ylmethyl naphthalene-1-carboxylate;hydrochloride is Cl.O=C(OCC1CCNCC1)c1cccc2ccccc12.
What is the InChIKey of piperidin-4-ylmethyl naphthalene-1-carboxylate;hydrochloride?
The InChIKey is UISXUORJVPUTJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2.ClH/c19-17(20-12-13-8-10-18-11-9-13)16-7-3-5-14-4-1-2-6-15(14)16;/h1-7,13,18H,8-12H2;1H.
What are the key properties of piperidin-4-ylmethyl naphthalene-1-carboxylate;hydrochloride?
piperidin-4-ylmethyl naphthalene-1-carboxylate;hydrochloride has a molecular weight of 305.80 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-ylmethyl naphthalene-1-carboxylate;hydrochloride is sourced from PubChem (CID 68534065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).