C7H14N2O — CID 118209815
2-oxa-5,9-diazabicyclo[6.2.0]decane (PubChem CID 118209815) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is 2-oxa-5,9-diazabicyclo[6.2.0]decane.
| Compound Name | 2-oxa-5,9-diazabicyclo[6.2.0]decane |
|---|---|
| PubChem CID | 118209815 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 2-oxa-5,9-diazabicyclo[6.2.0]decane |
| SMILES | C1COC2CNC2CCN1 |
| InChI | InChI=1S/C7H14N2O/c1-2-8-3-4-10-7-5-9-6(1)7/h6-9H,1-5H2 |
| InChIKey | BABRQRLLYPPGLN-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |