C9H16O3S2 — CID 102474179
2-[(2S)-oxan-2-yl]-1,3-dithiane 1,3-dioxide (PubChem CID 102474179) has the molecular formula C9H16O3S2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-[(2S)-oxan-2-yl]-1,3-dithiane 1,3-dioxide.
| Compound Name | 2-[(2S)-oxan-2-yl]-1,3-dithiane 1,3-dioxide |
|---|---|
| PubChem CID | 102474179 |
| Molecular Formula | C9H16O3S2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 2-[(2S)-oxan-2-yl]-1,3-dithiane 1,3-dioxide |
| SMILES | O=S1CCCS(=O)C1[C@@H]1CCCCO1 |
| InChI | InChI=1S/C9H16O3S2/c10-13-6-3-7-14(11)9(13)8-4-1-2-5-12-8/h8-9H,1-7H2/t8-,9?,13?,14?/m0/s1 |
| InChIKey | IASTUKJHLBBQKU-JSXQQCBFSA-N |
| XLogP | 0.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |