C8H14OS — CID 118210059
2,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-b]furan (PubChem CID 118210059) has the molecular formula C8H14OS and a molecular weight of 158.27 g/mol. Its IUPAC name is 2,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-b]furan.
| Compound Name | 2,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-b]furan |
|---|---|
| PubChem CID | 118210059 |
| Molecular Formula | C8H14OS |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 2,3,3a,4,5,7,8,8a-octahydrothiepino[4,5-b]furan |
| SMILES | C1CC2CCSCCC2O1 |
| InChI | InChI=1S/C8H14OS/c1-4-9-8-3-6-10-5-2-7(1)8/h7-8H,1-6H2 |
| InChIKey | SANQGRGWNQRXSS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |