About 2-cyclopropyloxetane
2-cyclopropyloxetane (PubChem CID 102488279) has the molecular formula C6H10O
and a molecular weight of 98.15 g/mol. Its IUPAC name is 2-cyclopropyloxetane.
Molecular Properties
| Compound Name | 2-cyclopropyloxetane |
| PubChem CID | 102488279 |
| Molecular Formula | C6H10O |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | 2-cyclopropyloxetane |
| SMILES | C1CC(C2CC2)O1 |
| InChI | InChI=1S/C6H10O/c1-2-5(1)6-3-4-7-6/h5-6H,1-4H2 |
| InChIKey | YMYCJPWFRJJVPJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclopropyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyloxetane?
The IUPAC name of 2-cyclopropyloxetane (CID 102488279) is 2-cyclopropyloxetane.
What is the SMILES notation for 2-cyclopropyloxetane?
The canonical SMILES for 2-cyclopropyloxetane is C1CC(C2CC2)O1.
What is the InChIKey of 2-cyclopropyloxetane?
The InChIKey is YMYCJPWFRJJVPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O/c1-2-5(1)6-3-4-7-6/h5-6H,1-4H2.
What are the key properties of 2-cyclopropyloxetane?
2-cyclopropyloxetane has a molecular weight of 98.15 g/mol, XLogP of 1.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyloxetane is sourced from PubChem (CID 102488279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).