C7H14O3 — CID 144869586
(3aR,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;methanol (PubChem CID 144869586) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is (3aR,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;methanol.
| Compound Name | (3aR,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;methanol |
|---|---|
| PubChem CID | 144869586 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | (3aR,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;methanol |
| SMILES | C1C[C@H]2OCC[C@H]2O1.CO |
| InChI | InChI=1S/C6H10O2.CH4O/c1-3-7-6-2-4-8-5(1)6;1-2/h5-6H,1-4H2;2H,1H3/t5-,6-;/m1./s1 |
| InChIKey | MBUGLQXHZZFLFB-KGZKBUQUSA-N |
| XLogP | 0.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |