C9H20O2 — CID 145399685
methanol;(2S,3R)-2,3,4-trimethyloxane (PubChem CID 145399685) has the molecular formula C9H20O2 and a molecular weight of 160.26 g/mol. Its IUPAC name is methanol;(2S,3R)-2,3,4-trimethyloxane.
| Compound Name | methanol;(2S,3R)-2,3,4-trimethyloxane |
|---|---|
| PubChem CID | 145399685 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | methanol;(2S,3R)-2,3,4-trimethyloxane |
| SMILES | CC1CCO[C@@H](C)[C@@H]1C.CO |
| InChI | InChI=1S/C8H16O.CH4O/c1-6-4-5-9-8(3)7(6)2;1-2/h6-8H,4-5H2,1-3H3;2H,1H3/t6?,7-,8+;/m1./s1 |
| InChIKey | HREWZNVVXNTBQF-JPPRQWMHSA-N |
| XLogP | 1.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |