About (3R)-2-methyloxolan-3-ol
(3R)-2-methyloxolan-3-ol (PubChem CID 89032581) has the molecular formula C5H10O2
and a molecular weight of 102.13 g/mol. Its IUPAC name is (3R)-2-methyloxolan-3-ol.
Molecular Properties
| Compound Name | (3R)-2-methyloxolan-3-ol |
| PubChem CID | 89032581 |
| Molecular Formula | C5H10O2 |
| Molecular Weight | 102.13 g/mol |
| Exact Mass | 102.07 |
| IUPAC Name | (3R)-2-methyloxolan-3-ol |
| SMILES | CC1OCC[C@H]1O |
| InChI | InChI=1S/C5H10O2/c1-4-5(6)2-3-7-4/h4-6H,2-3H2,1H3/t4?,5-/m1/s1 |
| InChIKey | ZFVWBUVYNPLIIS-BRJRFNKRSA-N |
| XLogP | 0.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.13 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-2-methyloxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2-methyloxolan-3-ol?
The IUPAC name of (3R)-2-methyloxolan-3-ol (CID 89032581) is (3R)-2-methyloxolan-3-ol.
What is the SMILES notation for (3R)-2-methyloxolan-3-ol?
The canonical SMILES for (3R)-2-methyloxolan-3-ol is CC1OCC[C@H]1O.
What is the InChIKey of (3R)-2-methyloxolan-3-ol?
The InChIKey is ZFVWBUVYNPLIIS-BRJRFNKRSA-N. The full InChI is InChI=1S/C5H10O2/c1-4-5(6)2-3-7-4/h4-6H,2-3H2,1H3/t4?,5-/m1/s1.
What are the key properties of (3R)-2-methyloxolan-3-ol?
(3R)-2-methyloxolan-3-ol has a molecular weight of 102.13 g/mol, XLogP of 0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2-methyloxolan-3-ol is sourced from PubChem (CID 89032581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).