About (3R)-2,3-dimethyl-1,4-dioxane
(3R)-2,3-dimethyl-1,4-dioxane (PubChem CID 134576356) has the molecular formula C6H12O2
and a molecular weight of 116.16 g/mol. Its IUPAC name is (3R)-2,3-dimethyl-1,4-dioxane.
Molecular Properties
| Compound Name | (3R)-2,3-dimethyl-1,4-dioxane |
| PubChem CID | 134576356 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | (3R)-2,3-dimethyl-1,4-dioxane |
| SMILES | CC1OCCO[C@@H]1C |
| InChI | InChI=1S/C6H12O2/c1-5-6(2)8-4-3-7-5/h5-6H,3-4H2,1-2H3/t5-,6?/m1/s1 |
| InChIKey | KOWWPSSAXLGXIZ-LWOQYNTDSA-N |
| XLogP | 0.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-2,3-dimethyl-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2,3-dimethyl-1,4-dioxane?
The IUPAC name of (3R)-2,3-dimethyl-1,4-dioxane (CID 134576356) is (3R)-2,3-dimethyl-1,4-dioxane.
What is the SMILES notation for (3R)-2,3-dimethyl-1,4-dioxane?
The canonical SMILES for (3R)-2,3-dimethyl-1,4-dioxane is CC1OCCO[C@@H]1C.
What is the InChIKey of (3R)-2,3-dimethyl-1,4-dioxane?
The InChIKey is KOWWPSSAXLGXIZ-LWOQYNTDSA-N. The full InChI is InChI=1S/C6H12O2/c1-5-6(2)8-4-3-7-5/h5-6H,3-4H2,1-2H3/t5-,6?/m1/s1.
What are the key properties of (3R)-2,3-dimethyl-1,4-dioxane?
(3R)-2,3-dimethyl-1,4-dioxane has a molecular weight of 116.16 g/mol, XLogP of 0.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2,3-dimethyl-1,4-dioxane is sourced from PubChem (CID 134576356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).