C5H10O2 — CID 13085378
(4R,5S)-4,5-dimethyl-1,3-dioxolane (PubChem CID 13085378) has the molecular formula C5H10O2 and a molecular weight of 102.13 g/mol. Its IUPAC name is (4R,5S)-4,5-dimethyl-1,3-dioxolane.
| Compound Name | (4R,5S)-4,5-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 13085378 |
| Molecular Formula | C5H10O2 |
| Molecular Weight | 102.13 g/mol |
| Exact Mass | 102.07 |
| IUPAC Name | (4R,5S)-4,5-dimethyl-1,3-dioxolane |
| SMILES | C[C@@H]1OCO[C@@H]1C |
| InChI | InChI=1S/C5H10O2/c1-4-5(2)7-3-6-4/h4-5H,3H2,1-2H3/t4-,5+ |
| InChIKey | GGQOXKOHMFKMLR-SYDPRGILSA-N |
| XLogP | 0.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.13 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |