C6H10O2 — CID 154265114
4-ethenyl-5-methyl-1,3-dioxolane (PubChem CID 154265114) has the molecular formula C6H10O2 and a molecular weight of 114.14 g/mol. Its IUPAC name is 4-ethenyl-5-methyl-1,3-dioxolane.
| Compound Name | 4-ethenyl-5-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 154265114 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | 4-ethenyl-5-methyl-1,3-dioxolane |
| SMILES | C=CC1OCOC1C |
| InChI | InChI=1S/C6H10O2/c1-3-6-5(2)7-4-8-6/h3,5-6H,1,4H2,2H3 |
| InChIKey | BKSCDIYOMKAAQK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|