C8H14O — CID 139439800
(2S,3R)-3-ethenyl-2-methyloxane (PubChem CID 139439800) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is (2S,3R)-3-ethenyl-2-methyloxane.
| Compound Name | (2S,3R)-3-ethenyl-2-methyloxane |
|---|---|
| PubChem CID | 139439800 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (2S,3R)-3-ethenyl-2-methyloxane |
| SMILES | C=C[C@H]1CCCO[C@H]1C |
| InChI | InChI=1S/C8H14O/c1-3-8-5-4-6-9-7(8)2/h3,7-8H,1,4-6H2,2H3/t7-,8-/m0/s1 |
| InChIKey | BESXIPHFNWHKNZ-YUMQZZPRSA-N |
| XLogP | 1.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|