C6H10O2 — CID 92908099
(2S,3R)-2-methyloxolane-3-carbaldehyde (PubChem CID 92908099) has the molecular formula C6H10O2 and a molecular weight of 114.14 g/mol. Its IUPAC name is (2S,3R)-2-methyloxolane-3-carbaldehyde.
| Compound Name | (2S,3R)-2-methyloxolane-3-carbaldehyde |
|---|---|
| PubChem CID | 92908099 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | (2S,3R)-2-methyloxolane-3-carbaldehyde |
| SMILES | C[C@@H]1OCC[C@H]1C=O |
| InChI | InChI=1S/C6H10O2/c1-5-6(4-7)2-3-8-5/h4-6H,2-3H2,1H3/t5-,6-/m0/s1 |
| InChIKey | LYPDDLMXKIDIDR-WDSKDSINSA-N |
| XLogP | 0.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|